C23H29N3O5 — CID 8846961
[2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate (PubChem CID 8846961) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8846961 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)OCC(=O)N(CCC#N)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29N3O5/c1-15(25-21(28)19-4-2-7-30-19)22(29)31-14-20(27)26(6-3-5-24)23-11-16-8-17(12-23)10-18(9-16)13-23/h2,4,7,15-18H,3,6,8-14H2,1H3,(H,25,28)/t15-,16?,17?,18?,23?/m0/s1 |
| InChIKey | ZOVWEWOHIFJPKE-SCUMNGBJSA-N |
| XLogP | 2.65 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |