C23H30ClN3O — CID 8598614
N-(1-adamantyl)-2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(2-cyanoethyl)acetamide (PubChem CID 8598614) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(2-cyanoethyl)acetamide.
| Compound Name | N-(1-adamantyl)-2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 8598614 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(1-adamantyl)-2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-(2-cyanoethyl)acetamide |
| SMILES | C[C@@H](NCC(=O)N(CCC#N)C12CC3CC(CC(C3)C1)C2)c1ccccc1Cl |
| InChI | InChI=1S/C23H30ClN3O/c1-16(20-5-2-3-6-21(20)24)26-15-22(28)27(8-4-7-25)23-12-17-9-18(13-23)11-19(10-17)14-23/h2-3,5-6,16-19,26H,4,8-15H2,1H3/t16-,17?,18?,19?,23?/m1/s1 |
| InChIKey | VNGJCEKEFVNFNP-DNBYOKIBSA-N |
| XLogP | 4.70 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |