C18H22N4O5 — CID 55306513
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 55306513) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 55306513 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccco1)C(=O)OCC(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C18H22N4O5/c1-13(2)16(21-17(24)14-6-3-11-26-14)18(25)27-12-15(23)22(9-4-7-19)10-5-8-20/h3,6,11,13,16H,4-5,9-10,12H2,1-2H3,(H,21,24) |
| InChIKey | QDZWNDNWJNEMIM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |