C21H26N4O4 — CID 29377218
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate (PubChem CID 29377218) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 29377218 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
| SMILES | Cc1ccc(C(=O)N[C@H](C(=O)OCC(=O)N(CCC#N)CCC#N)C(C)C)cc1 |
| InChI | InChI=1S/C21H26N4O4/c1-15(2)19(24-20(27)17-8-6-16(3)7-9-17)21(28)29-14-18(26)25(12-4-10-22)13-5-11-23/h6-9,15,19H,4-5,12-14H2,1-3H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | JGGQOEHNYDOJGM-IBGZPJMESA-N |
| XLogP | 1.95 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |