C17H26N2O3 — CID 2469416
2-(dimethylamino)ethyl (2R)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate (PubChem CID 2469416) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (2R)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate.
| Compound Name | 2-(dimethylamino)ethyl (2R)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 2469416 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-(dimethylamino)ethyl (2R)-3-methyl-2-[(4-methylbenzoyl)amino]butanoate |
| SMILES | Cc1ccc(C(=O)N[C@@H](C(=O)OCCN(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-12(2)15(17(21)22-11-10-19(4)5)18-16(20)14-8-6-13(3)7-9-14/h6-9,12,15H,10-11H2,1-5H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | HAOZIBCRPGREQC-OAHLLOKOSA-N |
| XLogP | 1.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |