C18H21N3O4 — CID 55316955
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(4-methylphenoxy)propanoate (PubChem CID 55316955) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(4-methylphenoxy)propanoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(4-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 55316955 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(4-methylphenoxy)propanoate |
| SMILES | Cc1ccc(OCCC(=O)OCC(=O)N(CCC#N)CCC#N)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-15-4-6-16(7-5-15)24-13-8-18(23)25-14-17(22)21(11-2-9-19)12-3-10-20/h4-7H,2-3,8,11-14H2,1H3 |
| InChIKey | LTGKTFIDASFYGG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |