C23H25BrN2O5 — CID 42967362
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate (PubChem CID 42967362) has the molecular formula C23H25BrN2O5 and a molecular weight of 489.37 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 42967362 |
| Molecular Formula | C23H25BrN2O5 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)CCCOc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C23H25BrN2O5/c1-2-29-20-11-9-19(10-12-20)26(14-5-13-25)22(27)17-31-23(28)8-4-15-30-21-7-3-6-18(24)16-21/h3,6-7,9-12,16H,2,4-5,8,14-15,17H2,1H3 |
| InChIKey | LDABKERJEQYBKT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|