C18H20FN3O4 — CID 9363417
[(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 9363417) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 9363417 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)[C@@H](NC(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C18H20FN3O4/c1-10(2)16(22-17(24)12-4-6-13(19)7-5-12)18(25)26-9-15(23)14(8-20)11(3)21/h4-7,10,14,16,21H,9H2,1-3H3,(H,22,24)/b21-11+/t14-,16-/m0/s1 |
| InChIKey | COHQCAJFRCEIHV-OPBOMBAJSA-N |
| XLogP | 1.87 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|