C16H16ClN3O4 — CID 7827117
(3-cyano-4-imino-2-oxopentyl) 3-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7827117) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827117 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)CCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3O4/c1-10(19)13(8-18)14(21)9-24-15(22)6-7-20-16(23)11-2-4-12(17)5-3-11/h2-5,13,19H,6-7,9H2,1H3,(H,20,23)/b19-10+ |
| InChIKey | QMPNMCJUMRKAHI-VXLYETTFSA-N |
| XLogP | 1.75 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|