C16H18N2O4 — CID 7988052
[(3R)-3-cyano-4-imino-2-oxopentyl] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 7988052) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7988052 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H18N2O4/c1-10-4-5-13(6-11(10)2)21-9-16(20)22-8-15(19)14(7-17)12(3)18/h4-6,14,18H,8-9H2,1-3H3/b18-12+/t14-/m0/s1 |
| InChIKey | ZQNWTBSURZJSJH-QCUKBLKESA-N |
| XLogP | 1.97 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|