C16H18N2O4 — CID 7840205
[(3R)-3-cyano-4-imino-2-oxopentyl] 3-(3-methylphenoxy)propanoate (PubChem CID 7840205) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 3-(3-methylphenoxy)propanoate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 3-(3-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7840205 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 3-(3-methylphenoxy)propanoate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)CCOc1cccc(C)c1 |
| InChI | InChI=1S/C16H18N2O4/c1-11-4-3-5-13(8-11)21-7-6-16(20)22-10-15(19)14(9-17)12(2)18/h3-5,8,14,18H,6-7,10H2,1-2H3/b18-12+/t14-/m0/s1 |
| InChIKey | QWOZMSSFUIEIPM-QCUKBLKESA-N |
| XLogP | 2.06 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|