C15H15BrN2O4 — CID 7880284
(3-cyano-4-imino-2-oxopentyl) 3-(3-bromophenoxy)propanoate (PubChem CID 7880284) has the molecular formula C15H15BrN2O4 and a molecular weight of 367.20 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3-(3-bromophenoxy)propanoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3-(3-bromophenoxy)propanoate |
|---|---|
| PubChem CID | 7880284 |
| Molecular Formula | C15H15BrN2O4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3-(3-bromophenoxy)propanoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C15H15BrN2O4/c1-10(18)13(8-17)14(19)9-22-15(20)5-6-21-12-4-2-3-11(16)7-12/h2-4,7,13,18H,5-6,9H2,1H3/b18-10+ |
| InChIKey | CJBWOHAKEVKJBQ-VCHYOVAHSA-N |
| XLogP | 2.51 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|