C14H13FN2O3 — CID 7932944
(3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)acetate (PubChem CID 7932944) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)acetate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7932944 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)acetate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN2O3/c1-9(17)12(7-16)13(18)8-20-14(19)6-10-2-4-11(15)5-3-10/h2-5,12,17H,6,8H2,1H3/b17-9+ |
| InChIKey | AIVSSVWMELMNAX-RQZCQDPDSA-N |
| XLogP | 1.66 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|