C16H18N2O6 — CID 7648355
(3-cyano-4-imino-2-oxopentyl) 2,3,4-trimethoxybenzoate (PubChem CID 7648355) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2,3,4-trimethoxybenzoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 7648355 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2,3,4-trimethoxybenzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H18N2O6/c1-9(18)11(7-17)12(19)8-24-16(20)10-5-6-13(21-2)15(23-4)14(10)22-3/h5-6,11,18H,8H2,1-4H3/b18-9+ |
| InChIKey | GFKNNFFVNXGVHG-GIJQJNRQSA-N |
| XLogP | 1.62 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|