C13H10Cl2N2O3 — CID 7648226
(3-cyano-4-imino-2-oxopentyl) 3,5-dichlorobenzoate (PubChem CID 7648226) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3,5-dichlorobenzoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7648226 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3,5-dichlorobenzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-7(17)11(5-16)12(18)6-20-13(19)8-2-9(14)4-10(15)3-8/h2-4,11,17H,6H2,1H3/b17-7+ |
| InChIKey | PGYXJHOSFHWUKQ-REZTVBANSA-N |
| XLogP | 2.90 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|