About (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate
(3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate (PubChem CID 8000893) has the molecular formula C13H12ClN3O3
and a molecular weight of 293.71 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate |
| PubChem CID | 8000893 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C13H12ClN3O3/c1-7(16)9(5-15)12(18)6-20-13(19)8-2-3-10(14)11(17)4-8/h2-4,9,16H,6,17H2,1H3/b16-7+ |
| InChIKey | FQXAZGXAIVQUAY-FRKPEAEDSA-N |
| XLogP | 1.83 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate?
The IUPAC name of (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate (CID 8000893) is (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate.
What is the SMILES notation for (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate?
The canonical SMILES for (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate is [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1ccc(Cl)c(N)c1.
What is the InChIKey of (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate?
The InChIKey is FQXAZGXAIVQUAY-FRKPEAEDSA-N. The full InChI is InChI=1S/C13H12ClN3O3/c1-7(16)9(5-15)12(18)6-20-13(19)8-2-3-10(14)11(17)4-8/h2-4,9,16H,6,17H2,1H3/b16-7+.
What are the key properties of (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate?
(3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate has a molecular weight of 293.71 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-4-imino-2-oxopentyl) 3-amino-4-chlorobenzoate is sourced from PubChem (CID 8000893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).