C16H16N4O5S — CID 7490614
(3-cyano-4-imino-2-oxopentyl) 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 7490614) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7490614 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C16H16N4O5S/c1-11(19)14(9-18)15(21)10-25-16(22)12-3-5-13(6-4-12)26(23,24)20-8-2-7-17/h3-6,14,19-20H,2,8,10H2,1H3/b19-11+ |
| InChIKey | FSEVCTBOOJSHSH-YBFXNURJSA-N |
| XLogP | 0.78 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|