C13H13N3O4S — CID 7490666
[(1R)-1-cyanoethyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 7490666) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [(1R)-1-cyanoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7490666 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [(1R)-1-cyanoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | C[C@H](C#N)OC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C13H13N3O4S/c1-10(9-15)20-13(17)11-3-5-12(6-4-11)21(18,19)16-8-2-7-14/h3-6,10,16H,2,8H2,1H3/t10-/m1/s1 |
| InChIKey | HAOHXPOWQPYSLC-SNVBAGLBSA-N |
| XLogP | 0.95 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|