C20H21N3O5S — CID 8509036
[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 8509036) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8509036 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-15(16-6-3-2-4-7-16)23-19(24)14-28-20(25)17-8-10-18(11-9-17)29(26,27)22-13-5-12-21/h2-4,6-11,15,22H,5,13-14H2,1H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | XRUKNKAVILBWHC-OAHLLOKOSA-N |
| XLogP | 1.91 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|