C19H18N2O4S — CID 8509084
[(E)-3-phenylprop-2-enyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 8509084) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8509084 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)OC/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c20-13-5-14-21-26(23,24)18-11-9-17(10-12-18)19(22)25-15-4-8-16-6-2-1-3-7-16/h1-4,6-12,21H,5,14-15H2/b8-4+ |
| InChIKey | ZSMULFJTFIMSPM-XBXARRHUSA-N |
| XLogP | 2.75 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|