C18H16N4O7S — CID 18277256
[2-(4-nitroanilino)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 18277256) has the molecular formula C18H16N4O7S and a molecular weight of 432.41 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18277256 |
| Molecular Formula | C18H16N4O7S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H16N4O7S/c19-10-1-11-20-30(27,28)16-8-2-13(3-9-16)18(24)29-12-17(23)21-14-4-6-15(7-5-14)22(25)26/h2-9,20H,1,11-12H2,(H,21,23) |
| InChIKey | IMHTYAUDNJDRRU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|