C16H21N3O5S — CID 8632755
[2-[methyl(propan-2-yl)amino]-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 8632755) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8632755 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | CC(C)N(C)C(=O)COC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C16H21N3O5S/c1-12(2)19(3)15(20)11-24-16(21)13-5-7-14(8-6-13)25(22,23)18-10-4-9-17/h5-8,12,18H,4,10-11H2,1-3H3 |
| InChIKey | KGNMDAMJIJUWKP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|