C22H24N2O5S — CID 55378975
[2-(2,5-diethylphenyl)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 55378975) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is [2-(2,5-diethylphenyl)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55378975 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | CCc1ccc(CC)c(C(=O)COC(=O)c2ccc(S(=O)(=O)NCCC#N)cc2)c1 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-16-6-7-17(4-2)20(14-16)21(25)15-29-22(26)18-8-10-19(11-9-18)30(27,28)24-13-5-12-23/h6-11,14,24H,3-5,13,15H2,1-2H3 |
| InChIKey | SOOMHUSFBGGKKZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|