C17H21N3O5S — CID 7578759
(2-oxo-2-piperidin-1-ylethyl) 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 7578759) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7578759 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)OCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c18-9-4-10-19-26(23,24)15-7-5-14(6-8-15)17(22)25-13-16(21)20-11-2-1-3-12-20/h5-8,19H,1-4,10-13H2 |
| InChIKey | BDKNXRWZQVSXNF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|