C23H21N5O5S — CID 24530924
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 24530924) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 24530924 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | CN1C(=C(C#N)C(=O)COC(=O)c2ccc(S(=O)(=O)NCCC#N)cc2)N(C)c2ccccc21 |
| InChI | InChI=1S/C23H21N5O5S/c1-27-19-6-3-4-7-20(19)28(2)22(27)18(14-25)21(29)15-33-23(30)16-8-10-17(11-9-16)34(31,32)26-13-5-12-24/h3-4,6-11,26H,5,13,15H2,1-2H3 |
| InChIKey | FFSBVLPKFWMRIB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|