C16H22N2O6S — CID 55401511
[2-[methyl(propan-2-yl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate (PubChem CID 55401511) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate.
| Compound Name | [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 55401511 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCC(=O)OCC(=O)N(C)C(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O6S/c1-11(2)18(4)15(20)10-24-16(21)9-17-25(22,23)14-7-5-13(6-8-14)12(3)19/h5-8,11,17H,9-10H2,1-4H3 |
| InChIKey | RLLYDXYHMMUPRR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |