C18H20N4O6S — CID 55311606
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate (PubChem CID 55311606) has the molecular formula C18H20N4O6S and a molecular weight of 420.45 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 55311606 |
| Molecular Formula | C18H20N4O6S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCC(=O)OCC(=O)N(CCC#N)CCC#N)cc1 |
| InChI | InChI=1S/C18H20N4O6S/c1-14(23)15-4-6-16(7-5-15)29(26,27)21-12-18(25)28-13-17(24)22(10-2-8-19)11-3-9-20/h4-7,21H,2-3,10-13H2,1H3 |
| InChIKey | QXOHYLHGCIHBMV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |