C15H18N2O6S — CID 166220509
[2-(azetidin-1-yl)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate (PubChem CID 166220509) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is [2-(azetidin-1-yl)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(azetidin-1-yl)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 166220509 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [2-(azetidin-1-yl)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCC(=O)OCC(=O)N2CCC2)cc1 |
| InChI | InChI=1S/C15H18N2O6S/c1-11(18)12-3-5-13(6-4-12)24(21,22)16-9-15(20)23-10-14(19)17-7-2-8-17/h3-6,16H,2,7-10H2,1H3 |
| InChIKey | UHVRZAIKRCPRMA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |