C16H22N4O4S — CID 8742825
4-(2-cyanoethylsulfamoyl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]benzamide (PubChem CID 8742825) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 8742825 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C16H22N4O4S/c1-3-10-18-15(21)12(2)20-16(22)13-5-7-14(8-6-13)25(23,24)19-11-4-9-17/h5-8,12,19H,3-4,10-11H2,1-2H3,(H,18,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | CSUOFNYIOSXSJY-GFCCVEGCSA-N |
| XLogP | 0.52 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|