C19H19N5O3S — CID 55471877
N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(2-cyanoethylsulfamoyl)benzamide (PubChem CID 55471877) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(2-cyanoethylsulfamoyl)benzamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(2-cyanoethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55471877 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(2-cyanoethylsulfamoyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H19N5O3S/c1-13(18-23-16-5-2-3-6-17(16)24-18)22-19(25)14-7-9-15(10-8-14)28(26,27)21-12-4-11-20/h2-3,5-10,13,21H,4,12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | VJSWIXIYNPXVIW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|