C21H20N4O4S — CID 18124167
N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 18124167) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 18124167 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H20N4O4S/c1-14(20-24-18-6-2-3-7-19(18)25-20)23-21(26)15-8-10-17(11-9-15)30(27,28)22-13-16-5-4-12-29-16/h2-12,14,22H,13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | RFEOMLWUGDDYOC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |