C18H17F2N3O3S — CID 46591250
4-(2-cyanoethylsulfamoyl)-N-[1-(2,5-difluorophenyl)ethyl]benzamide (PubChem CID 46591250) has the molecular formula C18H17F2N3O3S and a molecular weight of 393.42 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[1-(2,5-difluorophenyl)ethyl]benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[1-(2,5-difluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46591250 |
| Molecular Formula | C18H17F2N3O3S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[1-(2,5-difluorophenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)NCCC#N)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H17F2N3O3S/c1-12(16-11-14(19)5-8-17(16)20)23-18(24)13-3-6-15(7-4-13)27(25,26)22-10-2-9-21/h3-8,11-12,22H,2,10H2,1H3,(H,23,24) |
| InChIKey | NDCMEXLKFDFFSV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|