C18H17F2N3O4S — CID 56537065
N-[cyano-(2,4-difluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 56537065) has the molecular formula C18H17F2N3O4S and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56537065 |
| Molecular Formula | C18H17F2N3O4S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NC(C#N)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H17F2N3O4S/c1-27-9-8-22-28(25,26)14-5-2-12(3-6-14)18(24)23-17(11-21)15-7-4-13(19)10-16(15)20/h2-7,10,17,22H,8-9H2,1H3,(H,23,24) |
| InChIKey | JZBAKDGZTSSAKT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|