C21H15F2N3O3S — CID 56585745
3-(benzenesulfonamido)-N-[cyano-(2,4-difluorophenyl)methyl]benzamide (PubChem CID 56585745) has the molecular formula C21H15F2N3O3S and a molecular weight of 427.43 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[cyano-(2,4-difluorophenyl)methyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[cyano-(2,4-difluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 56585745 |
| Molecular Formula | C21H15F2N3O3S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[cyano-(2,4-difluorophenyl)methyl]benzamide |
| SMILES | N#CC(NC(=O)c1cccc(NS(=O)(=O)c2ccccc2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F2N3O3S/c22-15-9-10-18(19(23)12-15)20(13-24)25-21(27)14-5-4-6-16(11-14)26-30(28,29)17-7-2-1-3-8-17/h1-12,20,26H,(H,25,27) |
| InChIKey | AQLZISZMMDGBDW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |