C21H17F2N3O — CID 56584612
N-[cyano-(2,4-difluorophenyl)methyl]-4-(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 56584612) has the molecular formula C21H17F2N3O and a molecular weight of 365.38 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-4-(2,5-dimethylpyrrol-1-yl)benzamide.
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-(2,5-dimethylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 56584612 |
| Molecular Formula | C21H17F2N3O |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NC(C#N)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C21H17F2N3O/c1-13-3-4-14(2)26(13)17-8-5-15(6-9-17)21(27)25-20(12-24)18-10-7-16(22)11-19(18)23/h3-11,20H,1-2H3,(H,25,27) |
| InChIKey | BHGHNYBNGWNKBN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|