C21H14F2N2O — CID 56536876
N-[cyano-(2,4-difluorophenyl)methyl]-4-phenylbenzamide (PubChem CID 56536876) has the molecular formula C21H14F2N2O and a molecular weight of 348.35 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-4-phenylbenzamide.
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 56536876 |
| Molecular Formula | C21H14F2N2O |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-phenylbenzamide |
| SMILES | N#CC(NC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H14F2N2O/c22-17-10-11-18(19(23)12-17)20(13-24)25-21(26)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12,20H,(H,25,26) |
| InChIKey | NEFRNXYJSIHUOP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |