C18H12F2N4O — CID 95618021
N-[(S)-cyano-(2,4-difluorophenyl)methyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 95618021) has the molecular formula C18H12F2N4O and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[(S)-cyano-(2,4-difluorophenyl)methyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[(S)-cyano-(2,4-difluorophenyl)methyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95618021 |
| Molecular Formula | C18H12F2N4O |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[(S)-cyano-(2,4-difluorophenyl)methyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | N#C[C@@H](NC(=O)c1cnn(-c2ccccc2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H12F2N4O/c19-13-6-7-15(16(20)8-13)17(9-21)23-18(25)12-10-22-24(11-12)14-4-2-1-3-5-14/h1-8,10-11,17H,(H,23,25)/t17-/m1/s1 |
| InChIKey | WPVRJFWWGCYLHD-QGZVFWFLSA-N |
| XLogP | 3.15 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |