C18H13ClF2N2O — CID 86904225
(Z)-3-(2-chlorophenyl)-N-[cyano-(2,4-difluorophenyl)methyl]but-2-enamide (PubChem CID 86904225) has the molecular formula C18H13ClF2N2O and a molecular weight of 346.76 g/mol. Its IUPAC name is (Z)-3-(2-chlorophenyl)-N-[cyano-(2,4-difluorophenyl)methyl]but-2-enamide.
| Compound Name | (Z)-3-(2-chlorophenyl)-N-[cyano-(2,4-difluorophenyl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 86904225 |
| Molecular Formula | C18H13ClF2N2O |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (Z)-3-(2-chlorophenyl)-N-[cyano-(2,4-difluorophenyl)methyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)NC(C#N)c1ccc(F)cc1F)c1ccccc1Cl |
| InChI | InChI=1S/C18H13ClF2N2O/c1-11(13-4-2-3-5-15(13)19)8-18(24)23-17(10-22)14-7-6-12(20)9-16(14)21/h2-9,17H,1H3,(H,23,24)/b11-8- |
| InChIKey | NPLVCFUJAJMLCO-FLIBITNWSA-N |
| XLogP | 4.40 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|