C18H11F5N2O — CID 56584569
(E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 56584569) has the molecular formula C18H11F5N2O and a molecular weight of 366.29 g/mol. Its IUPAC name is (E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56584569 |
| Molecular Formula | C18H11F5N2O |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#CC(NC(=O)/C=C/c1cccc(C(F)(F)F)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H11F5N2O/c19-13-5-6-14(15(20)9-13)16(10-24)25-17(26)7-4-11-2-1-3-12(8-11)18(21,22)23/h1-9,16H,(H,25,26)/b7-4+ |
| InChIKey | VLTZXQAMGYHWSB-QPJJXVBHSA-N |
| XLogP | 4.38 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|