C19H17F2N3O4S — CID 56536824
(E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 56536824) has the molecular formula C19H17F2N3O4S and a molecular weight of 421.43 g/mol. Its IUPAC name is (E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56536824 |
| Molecular Formula | C19H17F2N3O4S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (E)-N-[cyano-(2,4-difluorophenyl)methyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)NC(C#N)c2ccc(F)cc2F)ccc1OC |
| InChI | InChI=1S/C19H17F2N3O4S/c1-23-29(26,27)18-9-12(3-7-17(18)28-2)4-8-19(25)24-16(11-22)14-6-5-13(20)10-15(14)21/h3-10,16,23H,1-2H3,(H,24,25)/b8-4+ |
| InChIKey | CBNRSIXACKEQHQ-XBXARRHUSA-N |
| XLogP | 2.28 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|