C15H17N3O4S2 — CID 55526444
3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 55526444) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55526444 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CNS(=O)(=O)c1cc(C=CC(=O)Nc2ncc(C)s2)ccc1OC |
| InChI | InChI=1S/C15H17N3O4S2/c1-10-9-17-15(23-10)18-14(19)7-5-11-4-6-12(22-3)13(8-11)24(20,21)16-2/h4-9,16H,1-3H3,(H,17,18,19) |
| InChIKey | HMFABNVCOUEQCH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|