C23H23N3O4S2 — CID 55465438
(E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 55465438) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55465438 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)Nc2ccc(SCc3cccnc3)cc2)ccc1OC |
| InChI | InChI=1S/C23H23N3O4S2/c1-24-32(28,29)22-14-17(5-11-21(22)30-2)6-12-23(27)26-19-7-9-20(10-8-19)31-16-18-4-3-13-25-15-18/h3-15,24H,16H2,1-2H3,(H,26,27)/b12-6+ |
| InChIKey | RQLAFDCPNSSMPH-WUXMJOGZSA-N |
| XLogP | 3.94 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|