C25H24N2O3S — CID 18281305
(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 18281305) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18281305 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2ccc(SCc3cccnc3)cc2)cc1OC |
| InChI | InChI=1S/C25H24N2O3S/c1-3-15-30-23-12-6-19(16-24(23)29-2)7-13-25(28)27-21-8-10-22(11-9-21)31-18-20-5-4-14-26-17-20/h3-14,16-17H,1,15,18H2,2H3,(H,27,28)/b13-7+ |
| InChIKey | AYTNDSQJSBHGML-NTUHNPAUSA-N |
| XLogP | 5.60 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|