C23H24N2O6 — CID 34073243
methyl 2-[[4-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]acetate (PubChem CID 34073243) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is methyl 2-[[4-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 34073243 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | methyl 2-[[4-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]acetate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2ccc(C(=O)NCC(=O)OC)cc2)cc1OC |
| InChI | InChI=1S/C23H24N2O6/c1-4-13-31-19-11-5-16(14-20(19)29-2)6-12-21(26)25-18-9-7-17(8-10-18)23(28)24-15-22(27)30-3/h4-12,14H,1,13,15H2,2-3H3,(H,24,28)(H,25,26)/b12-6+ |
| InChIKey | BZHAQSYOIKDSRG-WUXMJOGZSA-N |
| XLogP | 2.81 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|