C24H28N2O4 — CID 31287568
N,N-diethyl-3-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 31287568) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N,N-diethyl-3-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N,N-diethyl-3-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 31287568 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N,N-diethyl-3-[[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2cccc(C(=O)N(CC)CC)c2)cc1OC |
| InChI | InChI=1S/C24H28N2O4/c1-5-15-30-21-13-11-18(16-22(21)29-4)12-14-23(27)25-20-10-8-9-19(17-20)24(28)26(6-2)7-3/h5,8-14,16-17H,1,6-7,15H2,2-4H3,(H,25,27)/b14-12+ |
| InChIKey | QZNADVBQAZNLSI-WYMLVPIESA-N |
| XLogP | 4.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|