C22H21FN2O4S2 — CID 46565175
(E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 46565175) has the molecular formula C22H21FN2O4S2 and a molecular weight of 460.55 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46565175 |
| Molecular Formula | C22H21FN2O4S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)NC(c2ccc(F)cc2)c2cccs2)ccc1OC |
| InChI | InChI=1S/C22H21FN2O4S2/c1-24-31(27,28)20-14-15(5-11-18(20)29-2)6-12-21(26)25-22(19-4-3-13-30-19)16-7-9-17(23)10-8-16/h3-14,22,24H,1-2H3,(H,25,26)/b12-6+ |
| InChIKey | JRFKEEFRHCNIKG-WUXMJOGZSA-N |
| XLogP | 3.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|