C20H16FNOS — CID 8853725
(E)-3-(4-fluorophenyl)-N-[(R)-phenyl(thiophen-2-yl)methyl]prop-2-enamide (PubChem CID 8853725) has the molecular formula C20H16FNOS and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[(R)-phenyl(thiophen-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[(R)-phenyl(thiophen-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 8853725 |
| Molecular Formula | C20H16FNOS |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[(R)-phenyl(thiophen-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H16FNOS/c21-17-11-8-15(9-12-17)10-13-19(23)22-20(18-7-4-14-24-18)16-5-2-1-3-6-16/h1-14,20H,(H,22,23)/b13-10+/t20-/m1/s1 |
| InChIKey | IRAGZHZJSFZABO-XEDBTPMOSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|