C24H23FN2O3S — CID 46449714
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide (PubChem CID 46449714) has the molecular formula C24H23FN2O3S and a molecular weight of 438.52 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 46449714 |
| Molecular Formula | C24H23FN2O3S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(C)C(=O)NC(c2ccc(F)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C24H23FN2O3S/c1-16(26-22(28)14-7-17-5-12-20(30-2)13-6-17)24(29)27-23(21-4-3-15-31-21)18-8-10-19(25)11-9-18/h3-16,23H,1-2H3,(H,26,28)(H,27,29)/b14-7+ |
| InChIKey | SKIBLKZFQZWAIO-VGOFMYFVSA-N |
| XLogP | 4.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|