C22H18F3NO3S — CID 40984860
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]prop-2-enamide (PubChem CID 40984860) has the molecular formula C22H18F3NO3S and a molecular weight of 433.45 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]prop-2-enamide |
|---|---|
| PubChem CID | 40984860 |
| Molecular Formula | C22H18F3NO3S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N[C@@H](c2ccc(F)cc2)c2cccs2)ccc1OC(F)F |
| InChI | InChI=1S/C22H18F3NO3S/c1-28-18-13-14(4-10-17(18)29-22(24)25)5-11-20(27)26-21(19-3-2-12-30-19)15-6-8-16(23)9-7-15/h2-13,21-22H,1H3,(H,26,27)/b11-5+/t21-/m0/s1 |
| InChIKey | UQXZRRNXLGWJTL-JVNGFTGRSA-N |
| XLogP | 5.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|