C21H18FNO2S — CID 46565152
(E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 46565152) has the molecular formula C21H18FNO2S and a molecular weight of 367.45 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46565152 |
| Molecular Formula | C21H18FNO2S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C21H18FNO2S/c1-25-18-6-3-2-5-15(18)10-13-20(24)23-21(19-7-4-14-26-19)16-8-11-17(22)12-9-16/h2-14,21H,1H3,(H,23,24)/b13-10+ |
| InChIKey | WAXWQDFTTSOMRU-JLHYYAGUSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|